Ver en grande 
Fludarabine
S-S1491-50mg
Producto nuevo
Fludarabine
No hay puntos de fidelidad para este producto.
Ficha de datos
| Size | 50mg |
| Target | Moleculas Pequeñas |
| CAS Number | 21679-14-1 |
| Small Target | STAT |
| Pathway | JAK/STAT |
| Smiles | NC1=NC(=NC2=C1N=C[N]2C3OC(CO)C(O)C3O)F |
Más información
Fludarabine is a STAT1 activationinhibitor which causes a specific depletion of STAT1 protein (and mRNA) but not of other STATs. Also a DNA synthesisinhibitor in vascular smooth muscle cells. Fludarabine induces apoptosis.